EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23N4O4 |
| Net Charge | +1 |
| Average Mass | 299.351 |
| Monoisotopic Mass | 299.17138 |
| SMILES | C[N+](C)(C)[C@@H](CCc1ncc(C[C@H](N)C(=O)O)n1)C(=O)O |
| InChI | InChI=1S/C13H22N4O4/c1-17(2,3)10(13(20)21)4-5-11-15-7-8(16-11)6-9(14)12(18)19/h7,9-10H,4-6,14H2,1-3H3,(H2-,15,16,18,19,20,21)/p+1/t9-,10-/m0/s1 |
| InChIKey | CBQVLMCHMFGPMX-UWVGGRQHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphthine (CHEBI:18054) is a quaternary ammonium ion (CHEBI:35267) |
| diphthine (CHEBI:18054) is conjugate acid of diphthinate (CHEBI:58361) |
| Incoming Relation(s) |
| diphthinate (CHEBI:58361) is conjugate base of diphthine (CHEBI:18054) |
| diphthine betaine residue (CHEBI:82696) is substituent group from diphthine (CHEBI:18054) |
| diphthine residue (CHEBI:48230) is substituent group from diphthine (CHEBI:18054) |
| IUPAC Name |
|---|
| (1S)-3-{4-[(2S)-2-amino-2-carboxyethyl]-1H-imidazol-2-yl}-1-carboxy-N,N,N-trimethylpropan-1-aminium |
| Synonyms | Source |
|---|---|
| Diphthine | KEGG COMPOUND |
| 2-[(3S)-3-carboxy-3-(trimethylammonio)propyl]-L-histidine | ChEBI |
| Diphthine | KEGG COMPOUND |
| EF-2 diphthine | KEGG COMPOUND |
| Elongation factor 2 diphthine | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:75645-23-7 | ChemIDplus |