EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H4O6 |
| Net Charge | -2 |
| Average Mass | 184.103 |
| Monoisotopic Mass | 184.00189 |
| SMILES | O=C/C=C(\C=C(\O)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H6O6/c8-2-1-4(6(10)11)3-5(9)7(12)13/h1-3,9H,(H,10,11)(H,12,13)/p-2/b4-1+,5-3+ |
| InChIKey | YOMOLPRSDGXHCY-CLLRDSTBSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde(2−) (CHEBI:58358) is a dicarboxylic acid dianion (CHEBI:28965) |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde(2−) (CHEBI:58358) is conjugate base of 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde (CHEBI:18046) |
| Incoming Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde (CHEBI:18046) is conjugate acid of 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde(2−) (CHEBI:58358) |
| IUPAC Name |
|---|
| (2E,4E)-2-hydroxy-4-(2-oxoethylidene)pent-2-enedioate |
| Synonyms | Source |
|---|---|
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde | ChEBI |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde | UniProt |