EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18046 - 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde
| Formula | C7H6O6 |
| Net Charge | 0 |
| Average Mass | 186.119 |
| Monoisotopic Mass | 186.01644 |
| SMILES | O=C/C=C(\C=C(\O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-2-1-4(6(10)11)3-5(9)7(12)13/h1-3,9H,(H,10,11)(H,12,13)/b4-1+,5-3+ |
| InChIKey | YOMOLPRSDGXHCY-CLLRDSTBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde (CHEBI:18046) is a carboxy-2-hydroxymuconate semialdehyde (CHEBI:23022) |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde (CHEBI:18046) is conjugate acid of 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde(2−) (CHEBI:58358) |
| Incoming Relation(s) |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde(2−) (CHEBI:58358) is conjugate base of 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde (CHEBI:18046) |
| IUPAC Name |
|---|
| (2E,4E)-2-hydroxy-4-(2-oxoethylidene)pent-2-enedioic acid |
| Synonyms | Source |
|---|---|
| 4-Carboxy-2-hydroxymuconate semialdehyde | KEGG COMPOUND |
| 4-Carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde | KEGG COMPOUND |
| 2-hydroxy-4-carboxymuconate semialdehyde | ChEBI |
| 4-carboxy-2-hydroxy-cis,cis-muconate 6-semialdehyde | ChEBI |