EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H16O8 |
| Net Charge | 0 |
| Average Mass | 504.450 |
| Monoisotopic Mass | 504.08452 |
| SMILES | Cc1cc(O)c2c(=O)c3c(O)cc(O)c4c5c(O)cc(O)c6c(=O)c7c(O)cc(C)c8c1c2c(c34)c(c78)c65 |
| InChI | InChI=1S/C30H16O8/c1-7-3-9(31)19-23-15(7)16-8(2)4-10(32)20-24(16)28-26-18(12(34)6-14(36)22(26)30(20)38)17-11(33)5-13(35)21(29(19)37)25(17)27(23)28/h3-6,31-36H,1-2H3 |
| InChIKey | BTXNYTINYBABQR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hypericin (CHEBI:5835) has parent hydride bisanthene (CHEBI:49267) |
| hypericin (CHEBI:5835) has role antidepressant (CHEBI:35469) |
| hypericin (CHEBI:5835) is a carbopolycyclic compound (CHEBI:35294) |
| Incoming Relation(s) |
| St. John's wort extract (CHEBI:83161) has part hypericin (CHEBI:5835) |
| IUPAC Name |
|---|
| 1,3,4,6,8,13-hexahydroxy-10,11-dimethylphenanthro[1,10,9,8-opqra]perylene-7,14-dione |
| Synonyms | Source |
|---|---|
| Hypericin | KEGG COMPOUND |
| hypericum red | ChemIDplus |
| 1:6:8:10:11:13-hexahydroxy-3:4-dimethyl-meso-naphthodianthrene-7:14-dione | Patent |
| hipericina | ChEBI |
| Hyperizin | ChEBI |
| hypéricine | ChEBI |