EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H14 |
| Net Charge | 0 |
| Average Mass | 350.420 |
| Monoisotopic Mass | 350.10955 |
| SMILES | c1cc2cc3cccc4c5cccc6cc7cccc8c(c1)c2c(c34)c(c78)c65 |
| InChI | InChI=1S/C28H14/c1-5-15-13-16-6-3-11-21-22-12-4-8-18-14-17-7-2-10-20-19(9-1)23(15)27(25(16)21)28(24(17)20)26(18)22/h1-14H |
| InChIKey | RYQHWGXLBQHJST-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bisanthene (CHEBI:49267) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| Incoming Relation(s) |
| hypericin (CHEBI:5835) has parent hydride bisanthene (CHEBI:49267) |
| IUPAC Name |
|---|
| phenanthro[1,10,9,8-opqra]perylene |
| Synonym | Source |
|---|---|
| Bisanthen | ChEBI |