EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H38NO2 |
| Net Charge | +1 |
| Average Mass | 300.507 |
| Monoisotopic Mass | 300.28971 |
| SMILES | CCCCCCCCCCCCCCCC(=O)[C@@H]([NH3+])CO |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17,20H,2-16,19H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | KBUNOSOGGAARKZ-KRWDZBQOSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dehydrosphinganinium(1+) (CHEBI:58299) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3-dehydrosphinganinium(1+) (CHEBI:58299) has role human metabolite (CHEBI:77746) |
| 3-dehydrosphinganinium(1+) (CHEBI:58299) is a 3-dehydrosphingoid base(1+) (CHEBI:84411) |
| 3-dehydrosphinganinium(1+) (CHEBI:58299) is conjugate acid of 3-dehydrosphinganine (CHEBI:17862) |
| Incoming Relation(s) |
| N-acyl-3-ketodihydrosphingosine (CHEBI:189535) has functional parent 3-dehydrosphinganinium(1+) (CHEBI:58299) |
| N-palmitoyl-3-ketodihydrosphingosine (CHEBI:189534) has functional parent 3-dehydrosphinganinium(1+) (CHEBI:58299) |
| 3-dehydrosphinganine (CHEBI:17862) is conjugate base of 3-dehydrosphinganinium(1+) (CHEBI:58299) |
| IUPAC Name |
|---|
| (2S)-1-hydroxy-3-oxooctadecan-2-aminium |
| Synonyms | Source |
|---|---|
| 3-dehydrosphinganinium | ChEBI |
| 3-dehydrosphinganinium cation | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-oxosphinganine | UniProt |