EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H37NO2 |
| Net Charge | 0 |
| Average Mass | 299.499 |
| Monoisotopic Mass | 299.28243 |
| SMILES | CCCCCCCCCCCCCCCC(=O)[C@@H](N)CO |
| InChI | InChI=1S/C18H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17,20H,2-16,19H2,1H3/t17-/m0/s1 |
| InChIKey | KBUNOSOGGAARKZ-KRWDZBQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-dehydrosphinganine (CHEBI:17862) has functional parent sphinganine (CHEBI:16566) |
| 3-dehydrosphinganine (CHEBI:17862) has role mouse metabolite (CHEBI:75771) |
| 3-dehydrosphinganine (CHEBI:17862) is a 2-amino-1-hydroxyoctadecan-3-one (CHEBI:46966) |
| 3-dehydrosphinganine (CHEBI:17862) is conjugate base of 3-dehydrosphinganinium(1+) (CHEBI:58299) |
| Incoming Relation(s) |
| 1-deoxy-3-dehydrosphinganine (CHEBI:67176) has functional parent 3-dehydrosphinganine (CHEBI:17862) |
| 1-deoxymethyl-3-dehydrosphinganine (CHEBI:67186) has functional parent 3-dehydrosphinganine (CHEBI:17862) |
| 3-dehydrosphinganinium(1+) (CHEBI:58299) is conjugate acid of 3-dehydrosphinganine (CHEBI:17862) |
| IUPAC Name |
|---|
| (2S)-2-amino-1-hydroxyoctadecan-3-one |
| Synonyms | Source |
|---|---|
| 3-dehydro-D-sphinganine | ChEBI |
| 3-Dehydro-D-sphinganine | KEGG COMPOUND |
| 3-Dehydrosphinganine | KEGG COMPOUND |
| 3-ketodihydrosphingosine | ChEBI |
| 3-ketosphinganine | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| C02934 | KEGG COMPOUND |
| LMSP01020002 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6792651 | Reaxys |
| Beilstein:6792651 | Beilstein |
| Citations |
|---|