EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27ClN2O2 |
| Net Charge | 0 |
| Average Mass | 374.912 |
| Monoisotopic Mass | 374.17611 |
| SMILES | OCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2 |
| InChIKey | ZQDWXGKKHFNSQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyzine (CHEBI:5818) has role anticoronaviral agent (CHEBI:149553) |
| hydroxyzine (CHEBI:5818) has role antidepressant (CHEBI:35469) |
| hydroxyzine (CHEBI:5818) has role antipruritic drug (CHEBI:59683) |
| hydroxyzine (CHEBI:5818) has role antipsychotic agent (CHEBI:35476) |
| hydroxyzine (CHEBI:5818) has role anxiolytic drug (CHEBI:35474) |
| hydroxyzine (CHEBI:5818) has role dermatologic drug (CHEBI:50177) |
| hydroxyzine (CHEBI:5818) has role H1-receptor antagonist (CHEBI:37955) |
| hydroxyzine (CHEBI:5818) is a N-alkylpiperazine (CHEBI:46845) |
| hydroxyzine (CHEBI:5818) is a hydroxyether (CHEBI:46789) |
| hydroxyzine (CHEBI:5818) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| hydroxyzine hydrochloride (CHEBI:5819) has part hydroxyzine (CHEBI:5818) |
| hydroxyzine pamoate (CHEBI:31680) has part hydroxyzine (CHEBI:5818) |
| IUPAC Name |
|---|
| 2-(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)ethanol |
| INNs | Source |
|---|---|
| hidroxizina | ChemIDplus |
| hydroxyzine | ChemIDplus |
| hydroxyzinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Ataraxoid | ChEMBL |
| Hychotine | ChemIDplus |
| Hydroxine | ChemIDplus |
| Hydroxizine | ChemIDplus |
| Hydroxizinum | ChemIDplus |
| Hydroxycine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1400 | DrugCentral |
| 2977 | VSDB |
| C07045 | KEGG COMPOUND |
| D08054 | KEGG DRUG |
| DB00557 | DrugBank |
| HMDB0014697 | HMDB |
| Hydroxyzine | Wikipedia |
| LSM-5103 | LINCS |
| US2899436 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:321392 | Reaxys |
| CAS:68-88-2 | KEGG COMPOUND |
| CAS:68-88-2 | ChemIDplus |
| Citations |
|---|