EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27ClN2O2 |
| Net Charge | 0 |
| Average Mass | 374.912 |
| Monoisotopic Mass | 374.17611 |
| SMILES | OCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2 |
| InChIKey | ZQDWXGKKHFNSQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyzine (CHEBI:5818) has role anticoronaviral agent (CHEBI:149553) |
| hydroxyzine (CHEBI:5818) has role antipruritic drug (CHEBI:59683) |
| hydroxyzine (CHEBI:5818) has role anxiolytic drug (CHEBI:35474) |
| hydroxyzine (CHEBI:5818) has role dermatologic drug (CHEBI:50177) |
| hydroxyzine (CHEBI:5818) has role H1-receptor antagonist (CHEBI:37955) |
| hydroxyzine (CHEBI:5818) is a N-alkylpiperazine (CHEBI:46845) |
| hydroxyzine (CHEBI:5818) is a hydroxyether (CHEBI:46789) |
| hydroxyzine (CHEBI:5818) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| hydroxyzine hydrochloride (CHEBI:5819) has part hydroxyzine (CHEBI:5818) |
| hydroxyzine pamoate (CHEBI:31680) has part hydroxyzine (CHEBI:5818) |
| IUPAC Name |
|---|
| 2-(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)ethanol |
| INNs | Source |
|---|---|
| hidroxizina | ChemIDplus |
| hydroxyzine | ChemIDplus |
| hydroxyzinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Hychotine | ChemIDplus |
| Hydroxine | ChemIDplus |
| Hydroxizine | ChemIDplus |
| Hydroxizinum | ChemIDplus |
| Hydroxycine | ChemIDplus |
| Hydroxyzin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1400 | DrugCentral |
| 2977 | VSDB |
| C07045 | KEGG COMPOUND |
| D08054 | KEGG DRUG |
| DB00557 | DrugBank |
| HMDB0014697 | HMDB |
| Hydroxyzine | Wikipedia |
| LSM-5103 | LINCS |
| US2899436 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:321392 | Reaxys |
| CAS:68-88-2 | KEGG COMPOUND |
| CAS:68-88-2 | ChemIDplus |
| Citations |
|---|