EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27ClN2O2 |
| Net Charge | 0 |
| Average Mass | 374.912 |
| Monoisotopic Mass | 374.17611 |
| SMILES | OCCOCCN1CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H27ClN2O2/c22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-9,21,25H,10-17H2 |
| InChIKey | ZQDWXGKKHFNSQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | H1-receptor antagonist H1-receptor antagonists are the drugs that selectively bind to but do not activate histamine H1 receptors, thereby blocking the actions of endogenous histamine. antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyzine (CHEBI:5818) has role anticoronaviral agent (CHEBI:149553) |
| hydroxyzine (CHEBI:5818) has role antipruritic drug (CHEBI:59683) |
| hydroxyzine (CHEBI:5818) has role anxiolytic drug (CHEBI:35474) |
| hydroxyzine (CHEBI:5818) has role dermatologic drug (CHEBI:50177) |
| hydroxyzine (CHEBI:5818) has role H1-receptor antagonist (CHEBI:37955) |
| hydroxyzine (CHEBI:5818) is a N-alkylpiperazine (CHEBI:46845) |
| hydroxyzine (CHEBI:5818) is a hydroxyether (CHEBI:46789) |
| hydroxyzine (CHEBI:5818) is a monochlorobenzenes (CHEBI:83403) |
| Incoming Relation(s) |
| hydroxyzine hydrochloride (CHEBI:5819) has part hydroxyzine (CHEBI:5818) |
| hydroxyzine pamoate (CHEBI:31680) has part hydroxyzine (CHEBI:5818) |
| IUPAC Name |
|---|
| 2-(2-{4-[(4-chlorophenyl)(phenyl)methyl]piperazin-1-yl}ethoxy)ethanol |
| INNs | Source |
|---|---|
| hidroxizina | ChemIDplus |
| hydroxyzine | ChemIDplus |
| hydroxyzinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| Hydroxyzine | KEGG COMPOUND |
| Hychotine | ChemIDplus |
| Hydroxine | ChemIDplus |
| Hydroxizine | ChemIDplus |
| Hydroxizinum | ChemIDplus |
| Hydroxycine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07045 | KEGG COMPOUND |
| DB00557 | DrugBank |
| US2899436 | Patent |
| Hydroxyzine | Wikipedia |
| HMDB0014697 | HMDB |
| D08054 | KEGG DRUG |
| LSM-5103 | LINCS |
| 1400 | DrugCentral |
| 2977 | VSDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:321392 | Reaxys |
| CAS:68-88-2 | KEGG COMPOUND |
| CAS:68-88-2 | ChemIDplus |
| Citations |
|---|