EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H29ClN2O2.C23H14O6 |
| Net Charge | 0 |
| Average Mass | 763.287 |
| Monoisotopic Mass | 762.27079 |
| SMILES | O=C([O-])c1cc2ccccc2c(Cc2c(O)c(C(=O)[O-])cc3ccccc23)c1O.OCCOCC[NH+]1CC[NH+](C(c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C23H16O6.C21H27ClN2O2/c24-20-16(14-7-3-1-5-12(14)9-18(20)22(26)27)11-17-15-8-4-2-6-13(15)10-19(21(17)25)23(28)29;22-20-8-6-19(7-9-20)21(18-4-2-1-3-5-18)24-12-10-23(11-13-24)14-16-26-17-15-25/h1-10,24-25H,11H2,(H,26,27)(H,28,29);1-9,21,25H,10-17H2 |
| InChIKey | ASDOKGIIKXGMNB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxyzine pamoate (CHEBI:31680) has part hydroxyzine (CHEBI:5818) |
| hydroxyzine pamoate (CHEBI:31680) has part pamoate(2−) (CHEBI:50187) |
| hydroxyzine pamoate (CHEBI:31680) has role anxiolytic drug (CHEBI:35474) |
| hydroxyzine pamoate (CHEBI:31680) is a piperazinium salt (CHEBI:46849) |
| IUPAC Name |
|---|
| 1-[(4-chlorophenyl)(phenyl)methyl]-4-[2-(2-hydroxyethoxy)ethyl]piperazinediium 4,4'-methylenebis(3-hydroxynaphthalene-2-carboxylate) |
| Synonyms | Source |
|---|---|
| Hydroxyzine embonate | ChEMBL |
| Hydroxyzine pamoate | ChEMBL |
| Hydroxyzyne pamoate | ChemIDplus |
| NSC-757063 | ChEMBL |
| Brand Names | Source |
|---|---|
| Hy-pam | ChEMBL |
| hy-pam "25" | ChEMBL |
| Hy-pam "25" | ChEMBL |
| Vistaril | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:10246-75-0 | ChemIDplus |
| Citations |
|---|