EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8NOS |
| Net Charge | -1 |
| Average Mass | 166.225 |
| Monoisotopic Mass | 166.03321 |
| SMILES | O/N=C(\[S-])Cc1ccccc1 |
| InChI | InChI=1S/C8H9NOS/c10-9-8(11)6-7-4-2-1-3-5-7/h1-5,10H,6H2,(H,9,11)/p-1 |
| InChIKey | IHTJGIKQNHDTSX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylthioacetohydroximate (CHEBI:58176) is a organic anion (CHEBI:25696) |
| phenylthioacetohydroximate (CHEBI:58176) is conjugate base of phenylthioacetohydroximic acid (CHEBI:17520) |
| Incoming Relation(s) |
| phenylthioacetohydroximic acid (CHEBI:17520) is conjugate acid of phenylthioacetohydroximate (CHEBI:58176) |
| IUPAC Name |
|---|
| 2-phenylethanehydroximothioate |
| Synonyms | Source |
|---|---|
| phenylthioacetohydroximate(1−) | ChEBI |
| phenylthioacetohydroximate cation | ChEBI |
| UniProt Name | Source |
|---|---|
| (Z)-2-phenyl-1-thioacetohydroximate | UniProt |