EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NOS |
| Net Charge | 0 |
| Average Mass | 167.233 |
| Monoisotopic Mass | 167.04048 |
| SMILES | O/N=C(\S)Cc1ccccc1 |
| InChI | InChI=1S/C8H9NOS/c10-9-8(11)6-7-4-2-1-3-5-7/h1-5,10H,6H2,(H,9,11) |
| InChIKey | IHTJGIKQNHDTSX-UHFFFAOYSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylthioacetohydroximic acid (CHEBI:17520) is a acetohydroximates (CHEBI:22179) |
| phenylthioacetohydroximic acid (CHEBI:17520) is a organosulfur compound (CHEBI:33261) |
| phenylthioacetohydroximic acid (CHEBI:17520) is conjugate acid of phenylthioacetohydroximate (CHEBI:58176) |
| Incoming Relation(s) |
| phenylthioacetohydroximate (CHEBI:58176) is conjugate base of phenylthioacetohydroximic acid (CHEBI:17520) |
| IUPAC Name |
|---|
| N-hydroxy-2-phenylethanimidothioic acid |
| Synonym | Source |
|---|---|
| Phenylthioacetohydroximate | KEGG COMPOUND |