EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CCNC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | DATAGRPVKZEWHA-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-ethyl-L-glutamine zwitterion (CHEBI:58128) has role plant metabolite (CHEBI:76924) |
| N5-ethyl-L-glutamine zwitterion (CHEBI:58128) is a amino-acid zwitterion (CHEBI:35238) |
| N5-ethyl-L-glutamine zwitterion (CHEBI:58128) is tautomer of N5-ethyl-L-glutamine (CHEBI:17394) |
| Incoming Relation(s) |
| N5-ethyl-L-glutamine (CHEBI:17394) is tautomer of N5-ethyl-L-glutamine zwitterion (CHEBI:58128) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-(ethylamino)-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| theanine | ChEBI |
| theanine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| N5-ethyl-L-glutamine | UniProt |