EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CCNC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-2-9-6(10)4-3-5(8)7(11)12/h5H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | DATAGRPVKZEWHA-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role antipsychotic agent (CHEBI:35476) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role geroprotector (CHEBI:176497) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role neuroprotective agent (CHEBI:63726) |
| N5-ethyl-L-glutamine (CHEBI:17394) has role plant metabolite (CHEBI:76924) |
| N5-ethyl-L-glutamine (CHEBI:17394) is a N5-alkyl-L-glutamine (CHEBI:21844) |
| N5-ethyl-L-glutamine (CHEBI:17394) is tautomer of N5-ethyl-L-glutamine zwitterion (CHEBI:58128) |
| Incoming Relation(s) |
| N5-ethyl-L-glutamine zwitterion (CHEBI:58128) is tautomer of N5-ethyl-L-glutamine (CHEBI:17394) |
| IUPAC Names |
|---|
| (2S)-2-amino-5-(ethylamino)-5-oxopentanoic acid |
| N5-ethyl-L-glutamine |
| Synonyms | Source |
|---|---|
| L-Theanine | KEGG COMPOUND |
| N5-Ethyl-L-glutamine | KEGG COMPOUND |
| NSC-21308 | ChEMBL |
| L-theanine | ChemIDplus |
| theanine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 85G | PDBeChem |
| C01047 | KEGG COMPOUND |
| HMDB0034365 | HMDB |
| L-theanine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725586 | Reaxys |
| CAS:3081-61-6 | KEGG COMPOUND |
| CAS:3081-61-6 | ChemIDplus |
| Citations |
|---|