EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO5S |
| Net Charge | -1 |
| Average Mass | 168.150 |
| Monoisotopic Mass | 167.99722 |
| SMILES | [NH3+][C@@H](CS(=O)(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO5S/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/p-1/t2-/m0/s1 |
| InChIKey | XVOYSCVBGLVSOL-REOHCLBHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cysteate(1−) (CHEBI:58090) has role Escherichia coli metabolite (CHEBI:76971) |
| L-cysteate(1−) (CHEBI:58090) has role human metabolite (CHEBI:77746) |
| L-cysteate(1−) (CHEBI:58090) is a L-α-amino acid anion (CHEBI:59814) |
| L-cysteate(1−) (CHEBI:58090) is conjugate base of L-cysteic acid (CHEBI:17285) |
| Incoming Relation(s) |
| L-cysteic acid (CHEBI:17285) is conjugate acid of L-cysteate(1−) (CHEBI:58090) |
| L-cysteate residue (CHEBI:141830) is substituent group from L-cysteate(1−) (CHEBI:58090) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-sulfonatopropanoate |
| Synonyms | Source |
|---|---|
| (2R)-2-ammonio-3-sulfonatopropanoate | IUPAC |
| L-cysteate | ChEBI |
| L-cysteate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| L-cysteate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| L-CYSTEATE | MetaCyc |