EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H7NO5S |
| Net Charge | 0 |
| Average Mass | 169.158 |
| Monoisotopic Mass | 169.00449 |
| SMILES | N[C@@H](CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C3H7NO5S/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/t2-/m0/s1 |
| InChIKey | XVOYSCVBGLVSOL-REOHCLBHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (11750815) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (8981569) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cysteic acid (CHEBI:17285) has role Escherichia coli metabolite (CHEBI:76971) |
| L-cysteic acid (CHEBI:17285) has role human metabolite (CHEBI:77746) |
| L-cysteic acid (CHEBI:17285) is a L-alanine derivative (CHEBI:83943) |
| L-cysteic acid (CHEBI:17285) is a L-cysteine derivative (CHEBI:83824) |
| L-cysteic acid (CHEBI:17285) is a amino sulfonic acid (CHEBI:37793) |
| L-cysteic acid (CHEBI:17285) is a cysteic acid (CHEBI:21260) |
| L-cysteic acid (CHEBI:17285) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-cysteic acid (CHEBI:17285) is conjugate acid of L-cysteate(1−) (CHEBI:58090) |
| Incoming Relation(s) |
| L-cysteate(1−) (CHEBI:58090) is conjugate base of L-cysteic acid (CHEBI:17285) |
| IUPAC Name |
|---|
| L-cysteic acid |
| Synonyms | Source |
|---|---|
| 2-Amino-3-sulfopropionic acid | KEGG COMPOUND |
| (2R)-2-amino-3-sulfopropanoic acid | IUPAC |
| 3-Sulfoalanine | KEGG COMPOUND |
| 3-sulfo-L-alanine | PDBeChem |
| CYSTEINESULFONIC ACID | PDBeChem |
| L-Cysteate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00506 | KEGG COMPOUND |
| DB03661 | DrugBank |
| HMDB0002757 | HMDB |
| L-CYSTEATE | MetaCyc |
| OCS | PDBeChem |
| OCS_LFOH | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1725492 | Beilstein |
| Reaxys:1725495 | Reaxys |
| CAS:498-40-8 | ChemIDplus |
| Citations |
|---|