EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N2O18P2 |
| Net Charge | -3 |
| Average Mass | 577.261 |
| Monoisotopic Mass | 577.01246 |
| SMILES | O=C([O-])[C@H]1O[C@H](OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3ccc(=O)nc3=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H22N2O18P2/c18-5-1-2-17(15(26)16-5)12-9(22)6(19)4(32-12)3-31-36(27,28)35-37(29,30)34-14-10(23)7(20)8(21)11(33-14)13(24)25/h1-2,4,6-12,14,19-23H,3H2,(H,24,25)(H,27,28)(H,29,30)(H,16,18,26)/p-3/t4-,6-,7+,8+,9-,10-,11+,12-,14-/m1/s1 |
| InChIKey | HDYANYHVCAPMJV-LXQIFKJMSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-α-D-glucuronate(3−) (CHEBI:58052) has role human metabolite (CHEBI:77746) |
| UDP-α-D-glucuronate(3−) (CHEBI:58052) is a carbohydrate acid derivative anion (CHEBI:63551) |
| UDP-α-D-glucuronate(3−) (CHEBI:58052) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| UDP-α-D-glucuronate(3−) (CHEBI:58052) is conjugate base of UDP-α-D-glucuronic acid (CHEBI:17200) |
| Incoming Relation(s) |
| UDP-α-D-glucuronic acid (CHEBI:17200) is conjugate acid of UDP-α-D-glucuronate(3−) (CHEBI:58052) |
| Synonym | Source |
|---|---|
| UDP-α-D-glucuronate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| UDP-α-D-glucuronate | UniProt |