EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26ClN3O |
| Net Charge | 0 |
| Average Mass | 335.879 |
| Monoisotopic Mass | 335.17644 |
| SMILES | CCN(CCO)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3O/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21) |
| InChIKey | XXSMGPRMXLTPCZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. antirheumatic drug A drug used to treat rheumatoid arthritis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxychloroquine (CHEBI:5801) has functional parent chloroquine (CHEBI:3638) |
| hydroxychloroquine (CHEBI:5801) has role anticoronaviral agent (CHEBI:149553) |
| hydroxychloroquine (CHEBI:5801) has role antimalarial (CHEBI:38068) |
| hydroxychloroquine (CHEBI:5801) has role antirheumatic drug (CHEBI:35842) |
| hydroxychloroquine (CHEBI:5801) has role dermatologic drug (CHEBI:50177) |
| hydroxychloroquine (CHEBI:5801) is a aminoquinoline (CHEBI:36709) |
| hydroxychloroquine (CHEBI:5801) is a organochlorine compound (CHEBI:36683) |
| hydroxychloroquine (CHEBI:5801) is a primary alcohol (CHEBI:15734) |
| hydroxychloroquine (CHEBI:5801) is a secondary amino compound (CHEBI:50995) |
| hydroxychloroquine (CHEBI:5801) is a tertiary amino compound (CHEBI:50996) |
| hydroxychloroquine (CHEBI:5801) is conjugate base of hydroxychloroquine(2+) (CHEBI:149564) |
| Incoming Relation(s) |
| hydroxychloroquine(2+) (CHEBI:149564) is conjugate acid of hydroxychloroquine (CHEBI:5801) |
| IUPAC Name |
|---|
| 2-[{4-[(7-chloroquinolin-4-yl)amino]pentyl}(ethyl)amino]ethanol |
| INNs | Source |
|---|---|
| hidroxicloroquina | ChemIDplus |
| hydroxychloroquine | ChemIDplus |
| hydroxychloroquine | WHO MedNet |
| hydroxychloroquinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-((4-((7-chloro-4-quinolyl)amino)pentyl)ethylamino)ethanol | ChemIDplus |
| 2-(N-(4-(7-chlor-4-chinolylamino)-4-methylbutyl)ethylamino)ethanol | ChemIDplus |
| 7-chloro-4-(4-(N-ethyl-N-β-hydroxyethylamino)-1-methylbutylamino)quinoline | ChemIDplus |
| 7-chloro-4-[4-(N-ethyl-N-β-hydroxyethylamino)-1-methylbutylamino]quinoline | ChEBI |
| 7-chloro-4-(4-(ethyl(2-hydroxyethyl)amino)-1-methylbutylamino)quinoline | ChemIDplus |
| 7-chloro-4-[5-(N-ethyl-N-2-hydroxyethylamino)-2-pentyl]aminoquinoline | ChEBI |
| Brand Name | Source |
|---|---|
| Polirreumin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1395 | DrugCentral |
| C07043 | KEGG COMPOUND |
| D08050 | KEGG DRUG |
| DB01611 | DrugBank |
| HMDB0015549 | HMDB |
| Hydroxychloroquine | Wikipedia |
| LSM-5193 | LINCS |
| US2546658 | Patent |
| Citations |
|---|