EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26ClN3O |
| Net Charge | 0 |
| Average Mass | 335.879 |
| Monoisotopic Mass | 335.17644 |
| SMILES | CCN(CCO)CCCC(C)Nc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3O/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21) |
| InChIKey | XXSMGPRMXLTPCZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. antirheumatic drug A drug used to treat rheumatoid arthritis. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxychloroquine (CHEBI:5801) has functional parent chloroquine (CHEBI:3638) |
| hydroxychloroquine (CHEBI:5801) has role anticoronaviral agent (CHEBI:149553) |
| hydroxychloroquine (CHEBI:5801) has role antimalarial (CHEBI:38068) |
| hydroxychloroquine (CHEBI:5801) has role antirheumatic drug (CHEBI:35842) |
| hydroxychloroquine (CHEBI:5801) has role dermatologic drug (CHEBI:50177) |
| hydroxychloroquine (CHEBI:5801) is a aminoquinoline (CHEBI:36709) |
| hydroxychloroquine (CHEBI:5801) is a organochlorine compound (CHEBI:36683) |
| hydroxychloroquine (CHEBI:5801) is a primary alcohol (CHEBI:15734) |
| hydroxychloroquine (CHEBI:5801) is a secondary amino compound (CHEBI:50995) |
| hydroxychloroquine (CHEBI:5801) is a tertiary amino compound (CHEBI:50996) |
| hydroxychloroquine (CHEBI:5801) is conjugate base of hydroxychloroquine(2+) (CHEBI:149564) |
| Incoming Relation(s) |
| hydroxychloroquine(2+) (CHEBI:149564) is conjugate acid of hydroxychloroquine (CHEBI:5801) |
| IUPAC Name |
|---|
| 2-[{4-[(7-chloroquinolin-4-yl)amino]pentyl}(ethyl)amino]ethanol |
| INNs | Source |
|---|---|
| hidroxicloroquina | ChemIDplus |
| hydroxychloroquine | ChemIDplus |
| hydroxychloroquine | WHO MedNet |
| hydroxychloroquinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 2-((4-((7-chloro-4-quinolyl)amino)pentyl)ethylamino)ethanol | ChemIDplus |
| 2-(N-(4-(7-chlor-4-chinolylamino)-4-methylbutyl)ethylamino)ethanol | ChemIDplus |
| 7-chloro-4-(4-(N-ethyl-N-β-hydroxyethylamino)-1-methylbutylamino)quinoline | ChemIDplus |
| 7-chloro-4-[4-(N-ethyl-N-β-hydroxyethylamino)-1-methylbutylamino]quinoline | ChEBI |
| 7-chloro-4-(4-(ethyl(2-hydroxyethyl)amino)-1-methylbutylamino)quinoline | ChemIDplus |
| 7-chloro-4-[5-(N-ethyl-N-2-hydroxyethylamino)-2-pentyl]aminoquinoline | ChEBI |
| Brand Name | Source |
|---|---|
| Polirreumin | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1395 | DrugCentral |
| C07043 | KEGG COMPOUND |
| D08050 | KEGG DRUG |
| DB01611 | DrugBank |
| HMDB0015549 | HMDB |
| Hydroxychloroquine | Wikipedia |
| LSM-5193 | LINCS |
| US2546658 | Patent |
| Citations |
|---|