EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28ClN3O |
| Net Charge | +2 |
| Average Mass | 337.895 |
| Monoisotopic Mass | 337.19099 |
| SMILES | CC[NH+](CCO)CCCC(C)Nc1cc[nH+]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H26ClN3O/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21)/p+2 |
| InChIKey | XXSMGPRMXLTPCZ-UHFFFAOYSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxychloroquine(2+) (CHEBI:149564) is a quinolinium ion (CHEBI:52837) |
| hydroxychloroquine(2+) (CHEBI:149564) is a tertiary ammonium ion (CHEBI:137982) |
| hydroxychloroquine(2+) (CHEBI:149564) is conjugate acid of hydroxychloroquine (CHEBI:5801) |
| Incoming Relation(s) |
| hydroxychloroquine (CHEBI:5801) is conjugate base of hydroxychloroquine(2+) (CHEBI:149564) |
| IUPAC Name |
|---|
| 7-chloro-4-({5-[ethyl(2-hydroxyethyl)azaniumyl]pentan-2-yl}amino)quinolinium |
| Synonym | Source |
|---|---|
| hydroxychloroquine dication | SUBMITTER |
| Citations |
|---|