EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N3O7P |
| Net Charge | -1 |
| Average Mass | 304.175 |
| Monoisotopic Mass | 304.03401 |
| SMILES | Nc1ccn([C@@H]2O[C@@H]3COP(=O)([O-])O[C@H]3[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H12N3O7P/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14)/p-1/t4-,6-,7-,8-/m1/s1 |
| InChIKey | WCPTXJJVVDAEMW-XVFCMESISA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-cyclic CMP(1−) (CHEBI:58003) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 3',5'-cyclic CMP(1−) (CHEBI:58003) is a organophosphate oxoanion (CHEBI:58945) |
| 3',5'-cyclic CMP(1−) (CHEBI:58003) is conjugate base of 3',5'-cyclic CMP (CHEBI:17065) |
| Incoming Relation(s) |
| 3',5'-cyclic CMP (CHEBI:17065) is conjugate acid of 3',5'-cyclic CMP(1−) (CHEBI:58003) |
| IUPAC Name |
|---|
| cytidine 3',5'-phosphate |
| Synonyms | Source |
|---|---|
| 3',5'-cyclic CMP anion | ChEBI |
| cytidine 3',5'-phosphate(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 3',5'-cyclic CMP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5999856 | Reaxys |
| Citations |
|---|