EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:17065 - 3',5'-cyclic CMP
| Formula | C9H12N3O7P |
| Net Charge | 0 |
| Average Mass | 305.183 |
| Monoisotopic Mass | 305.04129 |
| SMILES | Nc1ccn([C@@H]2O[C@@H]3COP(=O)(O)O[C@H]3[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H12N3O7P/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | WCPTXJJVVDAEMW-XVFCMESISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25017019) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-cyclic CMP (CHEBI:17065) has role human metabolite (CHEBI:77746) |
| 3',5'-cyclic CMP (CHEBI:17065) is a 3',5'-cyclic pyrimidine nucleotide (CHEBI:19835) |
| 3',5'-cyclic CMP (CHEBI:17065) is conjugate acid of 3',5'-cyclic CMP(1−) (CHEBI:58003) |
| Incoming Relation(s) |
| 3',5'-cyclic CMP(1−) (CHEBI:58003) is conjugate base of 3',5'-cyclic CMP (CHEBI:17065) |
| IUPAC Name |
|---|
| cytidine 3',5'-(hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 3',5'-Cyclic CMP | KEGG COMPOUND |
| Cytidine 3',5'-cyclic monophosphate | KEGG COMPOUND |
| cCMP | ChEBI |
| Cyclic cmp | ChemIDplus |
| Cytidine, cyclic 3',5'-(hydrogen phosphate) | ChemIDplus |
| Citations |
|---|