EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5O5 |
| Net Charge | -1 |
| Average Mass | 145.090 |
| Monoisotopic Mass | 145.01425 |
| SMILES | COC(=O)CC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H6O5/c1-10-4(7)2-3(6)5(8)9/h2H2,1H3,(H,8,9)/p-1 |
| InChIKey | MAIRDOOJJIGWBJ-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaloacetate 4-methyl ester (CHEBI:57927) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| oxaloacetate 4-methyl ester (CHEBI:57927) is conjugate base of oxaloacetic acid 4-methyl ester (CHEBI:16859) |
| Incoming Relation(s) |
| oxaloacetic acid 4-methyl ester (CHEBI:16859) is conjugate acid of oxaloacetate 4-methyl ester (CHEBI:57927) |
| IUPAC Name |
|---|
| 4-methoxy-2,4-dioxobutanoate |
| Synonyms | Source |
|---|---|
| oxaloacetate 4-methyl ester(1−) | ChEBI |
| oxaloacetate 4-methyl ester anion | ChEBI |
| UniProt Name | Source |
|---|---|
| oxaloacetate 4-methyl ester | UniProt |