EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6O5 |
| Net Charge | 0 |
| Average Mass | 146.098 |
| Monoisotopic Mass | 146.02152 |
| SMILES | COC(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C5H6O5/c1-10-4(7)2-3(6)5(8)9/h2H2,1H3,(H,8,9) |
| InChIKey | MAIRDOOJJIGWBJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oxaloacetic acid 4-methyl ester (CHEBI:16859) has functional parent oxaloacetic acid (CHEBI:30744) |
| oxaloacetic acid 4-methyl ester (CHEBI:16859) is a dicarboxylic acid monoester (CHEBI:36244) |
| oxaloacetic acid 4-methyl ester (CHEBI:16859) is conjugate acid of oxaloacetate 4-methyl ester (CHEBI:57927) |
| Incoming Relation(s) |
| oxaloacetate 4-methyl ester (CHEBI:57927) is conjugate base of oxaloacetic acid 4-methyl ester (CHEBI:16859) |
| IUPAC Name |
|---|
| 4-methoxy-2,4-dioxobutanoic acid |
| Synonym | Source |
|---|---|
| Oxaloacetate 4-methyl ester | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:13192-05-7 | ChemIDplus |