EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2S |
| Net Charge | 0 |
| Average Mass | 149.215 |
| Monoisotopic Mass | 149.05105 |
| SMILES | CSCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | FFEARJCKVFRZRR-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-methionine zwitterion (CHEBI:57844) is a methionine zwitterion (CHEBI:64558) |
| L-methionine zwitterion (CHEBI:57844) is tautomer of L-methionine (CHEBI:16643) |
| Incoming Relation(s) |
| L-methionine (CHEBI:16643) is tautomer of L-methionine zwitterion (CHEBI:57844) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-4-(methylsulfanyl)butanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-4-(methylsulfanyl)butanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-methionine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| MET | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:560248 | Gmelin |