EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10NO3S |
| Net Charge | -1 |
| Average Mass | 176.217 |
| Monoisotopic Mass | 176.03869 |
| SMILES | [H]C(=O)N[C@@H](CCSC)C(=O)[O-] |
| InChI | InChI=1S/C6H11NO3S/c1-11-3-2-5(6(9)10)7-4-8/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10)/p-1/t5-/m0/s1 |
| InChIKey | PYUSHNKNPOHWEZ-YFKPBYRVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-methioninate (CHEBI:57809) is a N-acyl-L-α-amino acid anion (CHEBI:59874) |
| N-formyl-L-methioninate (CHEBI:57809) is conjugate base of N-formyl-L-methionine (CHEBI:16552) |
| Incoming Relation(s) |
| N-formyl-L-methionine (CHEBI:16552) is conjugate acid of N-formyl-L-methioninate (CHEBI:57809) |
| IUPAC Names |
|---|
| (2S)-2-formamido-4-(methylsulfanyl)butanoate |
| N-formyl-L-methioninate |
| Synonyms | Source |
|---|---|
| N-formyl-L-methioninate(1−) | ChEBI |
| N-formyl-L-methioninate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| Nα-formyl-L-methionine | UniProt |