EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3S |
| Net Charge | 0 |
| Average Mass | 177.225 |
| Monoisotopic Mass | 177.04596 |
| SMILES | [H]C(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C6H11NO3S/c1-11-3-2-5(6(9)10)7-4-8/h4-5H,2-3H2,1H3,(H,7,8)(H,9,10)/t5-/m0/s1 |
| InChIKey | PYUSHNKNPOHWEZ-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formyl-L-methionine (CHEBI:16552) has role metabolite (CHEBI:25212) |
| N-formyl-L-methionine (CHEBI:16552) is a N-formyl amino acid (CHEBI:50759) |
| N-formyl-L-methionine (CHEBI:16552) is a L-methionine derivative (CHEBI:84121) |
| N-formyl-L-methionine (CHEBI:16552) is a proteinogenic amino acid (CHEBI:83813) |
| N-formyl-L-methionine (CHEBI:16552) is conjugate acid of N-formyl-L-methioninate (CHEBI:57809) |
| Incoming Relation(s) |
| N-formyl-L-methionyl-L-leucyl-L-phenylalanine (CHEBI:53490) has functional parent N-formyl-L-methionine (CHEBI:16552) |
| 3'-(N-formyl-L-methionyl)-AMP (CHEBI:131556) has functional parent N-formyl-L-methionine (CHEBI:16552) |
| N-formyl-L-methioninate (CHEBI:57809) is conjugate base of N-formyl-L-methionine (CHEBI:16552) |
| N-formyl-L-methionyl group (CHEBI:49298) is substituent group from N-formyl-L-methionine (CHEBI:16552) |
| IUPAC Names |
|---|
| (2S)-2-formamido-4-(methylsulfanyl)butanoic acid |
| N-formyl-L-methionine |
| Synonyms | Source |
|---|---|
| (2S)-2-(formylamino)-4-(methylthio)butanoic acid | ChEBI |
| Formyl-methionine | KEGG COMPOUND |
| N-Formyl-L-methionine | KEGG COMPOUND |
| N-formylmethionine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C03145 | KEGG COMPOUND |
| DB04464 | DrugBank |
| FME | PDBeChem |
| Formylmethionine | Wikipedia |
| HMDB0001015 | HMDB |
| N-FORMYLMETHIONINE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725218 | Reaxys |
| CAS:4289-98-9 | KEGG COMPOUND |
| CAS:4289-98-9 | ChemIDplus |
| Citations |
|---|