EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CC(=O)N[C@@H](CCC[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C7H14N2O3/c1-5(10)9-6(7(11)12)3-2-4-8/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | JRLGPAXAGHMNOL-LURJTMIESA-N |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-acetyl-L-ornithine zwitterion (CHEBI:57805) has role Escherichia coli metabolite (CHEBI:76971) |
| N2-acetyl-L-ornithine zwitterion (CHEBI:57805) has role human metabolite (CHEBI:77746) |
| N2-acetyl-L-ornithine zwitterion (CHEBI:57805) is a amino-acid zwitterion (CHEBI:35238) |
| N2-acetyl-L-ornithine zwitterion (CHEBI:57805) is tautomer of N2-acetyl-L-ornithine (CHEBI:16543) |
| Incoming Relation(s) |
| N2-acetyl-L-ornithine (CHEBI:16543) is tautomer of N2-acetyl-L-ornithine zwitterion (CHEBI:57805) |
| IUPAC Name |
|---|
| (2S)-2-acetamido-5-azaniumylpentanoate |
| Synonym | Source |
|---|---|
| (2S)-2-acetamido-5-ammoniopentanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| N2-acetyl-L-ornithine | UniProt |