EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14N2O3 |
| Net Charge | 0 |
| Average Mass | 174.200 |
| Monoisotopic Mass | 174.10044 |
| SMILES | CC(=O)N[C@@H](CCCN)C(=O)O |
| InChI | InChI=1S/C7H14N2O3/c1-5(10)9-6(7(11)12)3-2-4-8/h6H,2-4,8H2,1H3,(H,9,10)(H,11,12)/t6-/m0/s1 |
| InChIKey | JRLGPAXAGHMNOL-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (21988831) | ||
| - | PubMed (19561621) | ||
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | MetaboLights (MTBLS125) | ||
| - | DOI (10.1371/journal.pone.0115359) | ||
| - | MetaboLights (MTBLS87) | ||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS88) | ||
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-acetyl-L-ornithine (CHEBI:16543) has role Escherichia coli metabolite (CHEBI:76971) |
| N2-acetyl-L-ornithine (CHEBI:16543) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| N2-acetyl-L-ornithine (CHEBI:16543) has role human metabolite (CHEBI:77746) |
| N2-acetyl-L-ornithine (CHEBI:16543) has role mouse metabolite (CHEBI:75771) |
| N2-acetyl-L-ornithine (CHEBI:16543) is a acetyl-L-ornithine (CHEBI:86496) |
| N2-acetyl-L-ornithine (CHEBI:16543) is a N2-acyl-L-ornithine (CHEBI:21815) |
| N2-acetyl-L-ornithine (CHEBI:16543) is tautomer of N2-acetyl-L-ornithine zwitterion (CHEBI:57805) |
| Incoming Relation(s) |
| N2-acetyl-L-ornithine zwitterion (CHEBI:57805) is tautomer of N2-acetyl-L-ornithine (CHEBI:16543) |
| IUPAC Names |
|---|
| (2S)-2-acetamido-5-aminopentanoic acid |
| N2-acetyl-L-ornithine |
| Synonyms | Source |
|---|---|
| N2-Acetyl-L-ornithine | KEGG COMPOUND |
| N2-Acetyl-L-ornithine | KEGG COMPOUND |
| N-Acetylornithine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| AOR | PDBeChem |
| C00437 | KEGG COMPOUND |
| ECMDB03357 | ECMDB |
| HMDB0003357 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1725555 | Reaxys |
| CAS:6205-08-9 | KEGG COMPOUND |
| Citations |
|---|