EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O13P3 |
| Net Charge | -3 |
| Average Mass | 504.158 |
| Monoisotopic Mass | 503.97392 |
| SMILES | Nc1nc(=O)c2ncn([C@H]3C[C@H](O)[C@@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)O3)c2n1 |
| InChI | InChI=1S/C10H16N5O13P3/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/p-3/t4-,5+,6+/m0/s1 |
| InChIKey | HAAZLUGHYHWQIW-KVQBGUIXSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dGTP(3−) (CHEBI:57794) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dGTP(3−) (CHEBI:57794) is a 2'-deoxyribonucleoside triphosphate oxoanion (CHEBI:61662) |
| dGTP(3−) (CHEBI:57794) is conjugate acid of dGTP(4−) (CHEBI:61429) |
| dGTP(3−) (CHEBI:57794) is conjugate base of dGTP (CHEBI:16497) |
| Incoming Relation(s) |
| dGTP (CHEBI:16497) is conjugate acid of dGTP(3−) (CHEBI:57794) |
| dGTP(4−) (CHEBI:61429) is conjugate base of dGTP(3−) (CHEBI:57794) |
| IUPAC Name |
|---|
| 2'-deoxy-5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]guanosine |
| Synonym | Source |
|---|---|
| dGTP trianion | ChEBI |