EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N5O13P3 |
| Net Charge | 0 |
| Average Mass | 507.182 |
| Monoisotopic Mass | 506.99575 |
| SMILES | Nc1nc(=O)c2ncn([C@H]3C[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O3)c2n1 |
| InChI | InChI=1S/C10H16N5O13P3/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(26-6)2-25-30(21,22)28-31(23,24)27-29(18,19)20/h3-6,16H,1-2H2,(H,21,22)(H,23,24)(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
| InChIKey | HAAZLUGHYHWQIW-KVQBGUIXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | MetaboLights (MTBLS129) | From MetaboLights |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | |||
| - | PubMed (19425150) | Source: BioModels - MODEL1507180067 | |
| - | MetaboLights (MTBLS225) | From MetaboLights | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (7929110) | |
| Solanum lycopersicum (ncbitaxon:4081) | leaf (BTO:0000713) | MetaboLights (MTBLS297) | From MetaboLights |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dGTP (CHEBI:16497) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| dGTP (CHEBI:16497) has role Escherichia coli metabolite (CHEBI:76971) |
| dGTP (CHEBI:16497) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| dGTP (CHEBI:16497) has role human metabolite (CHEBI:77746) |
| dGTP (CHEBI:16497) has role mouse metabolite (CHEBI:75771) |
| dGTP (CHEBI:16497) has role plant metabolite (CHEBI:76924) |
| dGTP (CHEBI:16497) is a deoxyguanosine phosphate (CHEBI:23625) |
| dGTP (CHEBI:16497) is a guanyl deoxyribonucleotide (CHEBI:63573) |
| dGTP (CHEBI:16497) is a purine 2'-deoxyribonucleoside 5'-triphosphate (CHEBI:37042) |
| dGTP (CHEBI:16497) is conjugate acid of dGTP(3−) (CHEBI:57794) |
| Incoming Relation(s) |
| dGTP(3−) (CHEBI:57794) is conjugate base of dGTP (CHEBI:16497) |
| IUPAC Name |
|---|
| 2'-deoxyguanosine 5'-(tetrahydrogen triphosphate) |
| Synonyms | Source |
|---|---|
| 2'-deoxy-GTP | ChEBI |
| 2'-deoxyguanosine 5'-triphosphate | KEGG COMPOUND |
| 2'-deoxyguanosine triphosphate | ChEBI |
| deoxy-GTP | HMDB |
| deoxyguanosine 5'-triphosphate | KEGG COMPOUND |
| deoxyguanosine triphosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 58613 | ChemSpider |
| C00019346 | KNApSAcK |
| C00286 | KEGG COMPOUND |
| DB02181 | DrugBank |
| Deoxyguanosine_triphosphate | Wikipedia |
| DGT | PDBeChem |
| ECMDB01440 | ECMDB |
| FDB022623 | FooDB |
| HMDB0001440 | HMDB |
| YMDB00744 | YMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:73481 | Reaxys |
| CAS:2564-35-4 | ChemIDplus |
| Citations |
|---|