EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8N4 |
| Net Charge | 0 |
| Average Mass | 160.180 |
| Monoisotopic Mass | 160.07490 |
| SMILES | NNc1nncc2ccccc12 |
| InChI | InChI=1S/C8H8N4/c9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-5H,9H2,(H,11,12) |
| InChIKey | RPTUSVTUFVMDQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydralazine (CHEBI:5775) has role antihypertensive agent (CHEBI:35674) |
| hydralazine (CHEBI:5775) has role vasodilator agent (CHEBI:35620) |
| hydralazine (CHEBI:5775) is a ortho-fused heteroarene (CHEBI:52362) |
| hydralazine (CHEBI:5775) is a azaarene (CHEBI:50893) |
| hydralazine (CHEBI:5775) is a hydrazines (CHEBI:24631) |
| hydralazine (CHEBI:5775) is a phthalazines (CHEBI:38768) |
| Incoming Relation(s) |
| hydralazine hydrochloride (CHEBI:31672) has part hydralazine (CHEBI:5775) |
| IUPAC Name |
|---|
| 1-hydrazinophthalazine |
| INNs | Source |
|---|---|
| hidralazina | ChemIDplus |
| hydralazine | KEGG DRUG |
| hydralazinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-Hydrazinophthalazine | ChemIDplus |
| 1-Phthalazinylhydrazine | ChemIDplus |
| (1Z)-1(2H)-Phthalazinone hydrazone | NIST Chemistry WebBook |
| (2H)-Phthalazinone hydrazone | ChemIDplus |
| 6-Hydralazine | ChemIDplus |
| Hydralazin | ChemIDplus |
| Citations |
|---|