EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8N4.HCl |
| Net Charge | 0 |
| Average Mass | 196.641 |
| Monoisotopic Mass | 196.05157 |
| SMILES | Cl.NNc1nncc2ccccc12 |
| InChI | InChI=1S/C8H8N4.ClH/c9-11-8-7-4-2-1-3-6(7)5-10-12-8;/h1-5H,9H2,(H,11,12);1H |
| InChIKey | ZUXNZUWOTSUBMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydralazine hydrochloride (CHEBI:31672) has part hydralazine (CHEBI:5775) |
| hydralazine hydrochloride (CHEBI:31672) has role antihypertensive agent (CHEBI:35674) |
| hydralazine hydrochloride (CHEBI:31672) has role vasodilator agent (CHEBI:35620) |
| hydralazine hydrochloride (CHEBI:31672) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-hydrazinophthalazine hydrochloride |
| Synonyms | Source |
|---|---|
| 1(2H)-Phthalazinone hydrazone hydrochloride | ChemIDplus |
| 1-Hydrazinophthalazine hydrochloride | ChemIDplus |
| 1-Hydrazinophthalazine monohydrochloride | ChemIDplus |
| Hydralazine chloride | ChemIDplus |
| Hydralazine HCl | ChemIDplus |
| Hydralazine monohydrochloride | ChemIDplus |
| Citations |
|---|