EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8N4.HCl |
| Net Charge | 0 |
| Average Mass | 196.641 |
| Monoisotopic Mass | 196.05157 |
| SMILES | Cl.NNc1nncc2ccccc12 |
| InChI | InChI=1S/C8H8N4.ClH/c9-11-8-7-4-2-1-3-6(7)5-10-12-8;/h1-5H,9H2,(H,11,12);1H |
| InChIKey | ZUXNZUWOTSUBMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | vasodilator agent A drug used to cause dilation of the blood vessels. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. ophthalmology drug Any compound used for the treatment of eye conditions or eye diseases. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydralazine hydrochloride (CHEBI:31672) has part hydralazine (CHEBI:5775) |
| hydralazine hydrochloride (CHEBI:31672) has role antihypertensive agent (CHEBI:35674) |
| hydralazine hydrochloride (CHEBI:31672) has role cardiovascular drug (CHEBI:35554) |
| hydralazine hydrochloride (CHEBI:31672) has role ophthalmology drug (CHEBI:66981) |
| hydralazine hydrochloride (CHEBI:31672) has role vasodilator agent (CHEBI:35620) |
| hydralazine hydrochloride (CHEBI:31672) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 1-hydrazinophthalazine hydrochloride |
| Synonyms | Source |
|---|---|
| 1(2H)-Phthalazinone hydrazone hydrochloride | ChemIDplus |
| 1-Hydrazinophthalazine hydrochloride | ChemIDplus |
| 1-Hydrazinophthalazine monohydrochloride | ChemIDplus |
| Apressinum | ChEMBL |
| Hydralazine chloride | ChemIDplus |
| Hydralazine HCl | ChemIDplus |
| Brand Names | Source |
|---|---|
| Apresoline | ChEMBL |
| Dralzine | ChEMBL |
| Hydralazine hydrochloride component of apresazide | ChEMBL |
| Hydralazine hydrochloride component of apresoline-esidrix | ChEMBL |
| Hydralazine hydrochloride component of bidil | ChEMBL |
| Hydralazine hydrochloride component of cam-ap-es | ChEMBL |
| Citations |
|---|