EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H5N2O4 |
| Net Charge | -1 |
| Average Mass | 157.105 |
| Monoisotopic Mass | 157.02548 |
| SMILES | O=C([O-])C[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O4/c8-3(9)1-2-4(10)7-5(11)6-2/h2H,1H2,(H,8,9)(H2,6,7,10,11)/p-1/t2-/m0/s1 |
| InChIKey | DQQLZADYSWBCOX-REOHCLBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-5-carboxylatomethylhydantoin(1−) (CHEBI:57740) is a monocarboxylic acid anion (CHEBI:35757) |
| L-5-carboxylatomethylhydantoin(1−) (CHEBI:57740) is conjugate base of L-5-carboxymethylhydantoin (CHEBI:16342) |
| Incoming Relation(s) |
| L-5-carboxymethylhydantoin (CHEBI:16342) is conjugate acid of L-5-carboxylatomethylhydantoin(1−) (CHEBI:57740) |
| IUPAC Name |
|---|
| [(4S)-2,5-dioxoimidazolidin-4-yl]acetate |
| Synonyms | Source |
|---|---|
| L-5-carboxylatomethylhydantoin anion | ChEBI |
| L-5-carboxylatomethylhydantoin | ChEBI |
| UniProt Name | Source |
|---|---|
| L-5-carboxymethylhydantoin | UniProt |