EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H6N2O4 |
| Net Charge | 0 |
| Average Mass | 158.113 |
| Monoisotopic Mass | 158.03276 |
| SMILES | O=C(O)C[C@@H]1NC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O4/c8-3(9)1-2-4(10)7-5(11)6-2/h2H,1H2,(H,8,9)(H2,6,7,10,11)/t2-/m0/s1 |
| InChIKey | DQQLZADYSWBCOX-REOHCLBHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-5-carboxymethylhydantoin (CHEBI:16342) has functional parent hydantoin (CHEBI:27612) |
| L-5-carboxymethylhydantoin (CHEBI:16342) is a imidazolidine-2,4-dione (CHEBI:24628) |
| L-5-carboxymethylhydantoin (CHEBI:16342) is conjugate acid of L-5-carboxylatomethylhydantoin(1−) (CHEBI:57740) |
| Incoming Relation(s) |
| L-5-carboxylatomethylhydantoin(1−) (CHEBI:57740) is conjugate base of L-5-carboxymethylhydantoin (CHEBI:16342) |
| IUPAC Name |
|---|
| [(4S)-2,5-dioxoimidazolidin-4-yl]acetic acid |
| Synonym | Source |
|---|---|
| L-5-Carboxymethylhydantoin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C03703 | KEGG COMPOUND |