EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | CC(C)=CCC1=C(O)[C@](O)(CC=C(C)C)C(=O)C(C(=O)CC(C)C)=C1O |
| InChI | InChI=1S/C21H30O5/c1-12(2)7-8-15-18(23)17(16(22)11-14(5)6)20(25)21(26,19(15)24)10-9-13(3)4/h7,9,14,23-24,26H,8,10-11H2,1-6H3/t21-/m1/s1 |
| InChIKey | VMSLCPKYRPDHLN-OAQYLSRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | cone (BTO:0000280) | PubMed (22111577) | EtOH extract of hop cones |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antibacterial drug A drug used to treat or prevent bacterial infections. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| humulone (CHEBI:5769) has role antibacterial drug (CHEBI:36047) |
| humulone (CHEBI:5769) has role antioxidant (CHEBI:22586) |
| humulone (CHEBI:5769) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| humulone (CHEBI:5769) has role metabolite (CHEBI:25212) |
| humulone (CHEBI:5769) is a aromatic ketone (CHEBI:76224) |
| humulone (CHEBI:5769) is a cyclic ketone (CHEBI:3992) |
| humulone (CHEBI:5769) is a diketone (CHEBI:46640) |
| humulone (CHEBI:5769) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| humulone (CHEBI:5769) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (6R)-3,5,6-trihydroxy-2-(3-methylbutanoyl)-4,6-bis(3-methylbut-2-en-1-yl)cyclohexa-2,4-dien-1-one |
| Synonyms | Source |
|---|---|
| Humulone | KEGG COMPOUND |
| (6R)-3,5,6-trihydroxy-2-isovaleryl-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dienone | ChemIDplus |
| α-humulon | ChemIDplus |
| humulon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C10695 | KEGG COMPOUND |
| US2011021610 | Patent |
| WO2009114939 | Patent |
| DE102007028397 | Patent |
| CN101134719 | Patent |
| C00002697 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3221160 | Reaxys |
| CAS:23510-81-8 | KEGG COMPOUND |
| CAS:26472-41-3 | ChemIDplus |
| Citations |
|---|