EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O5 |
| Net Charge | 0 |
| Average Mass | 362.466 |
| Monoisotopic Mass | 362.20932 |
| SMILES | CC(C)=CCC1=C(O)[C@](O)(CC=C(C)C)C(=O)C(C(=O)CC(C)C)=C1O |
| InChI | InChI=1S/C21H30O5/c1-12(2)7-8-15-18(23)17(16(22)11-14(5)6)20(25)21(26,19(15)24)10-9-13(3)4/h7,9,14,23-24,26H,8,10-11H2,1-6H3/t21-/m1/s1 |
| InChIKey | VMSLCPKYRPDHLN-OAQYLSRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | cone (BTO:0000280) | PubMed (22111577) | EtOH extract of hop cones |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. antibacterial drug A drug used to treat or prevent bacterial infections. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| humulone (CHEBI:5769) has role antibacterial drug (CHEBI:36047) |
| humulone (CHEBI:5769) has role antioxidant (CHEBI:22586) |
| humulone (CHEBI:5769) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| humulone (CHEBI:5769) has role metabolite (CHEBI:25212) |
| humulone (CHEBI:5769) is a aromatic ketone (CHEBI:76224) |
| humulone (CHEBI:5769) is a cyclic ketone (CHEBI:3992) |
| humulone (CHEBI:5769) is a diketone (CHEBI:46640) |
| humulone (CHEBI:5769) is a tertiary α-hydroxy ketone (CHEBI:139592) |
| humulone (CHEBI:5769) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (6R)-3,5,6-trihydroxy-2-(3-methylbutanoyl)-4,6-bis(3-methylbut-2-en-1-yl)cyclohexa-2,4-dien-1-one |
| Synonyms | Source |
|---|---|
| (6R)-3,5,6-trihydroxy-2-isovaleryl-4,6-bis(3-methylbut-2-enyl)cyclohexa-2,4-dienone | ChemIDplus |
| humulon | ChemIDplus |
| Humulone | KEGG COMPOUND |
| α-humulon | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002697 | KNApSAcK |
| C10695 | KEGG COMPOUND |
| CN101134719 | Patent |
| DE102007028397 | Patent |
| US2011021610 | Patent |
| WO2009114939 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3221160 | Reaxys |
| CAS:23510-81-8 | KEGG COMPOUND |
| CAS:26472-41-3 | ChemIDplus |
| Citations |
|---|