EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO4S |
| Net Charge | -1 |
| Average Mass | 178.189 |
| Monoisotopic Mass | 178.01795 |
| SMILES | [NH3+][C@@H](CSCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C5H9NO4S/c6-3(5(9)10)1-11-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1 |
| InChIKey | GBFLZEXEOZUWRN-VKHMYHEASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-carboxylatomethyl-L-cysteine(1−) (CHEBI:57662) is a dicarboxylic acid anion (CHEBI:35693) |
| S-carboxylatomethyl-L-cysteine(1−) (CHEBI:57662) is a α-amino-acid anion (CHEBI:33558) |
| S-carboxylatomethyl-L-cysteine(1−) (CHEBI:57662) is conjugate base of S-carboxymethyl-L-cysteine (CHEBI:16163) |
| Incoming Relation(s) |
| S-carboxymethyl-L-cysteine (CHEBI:16163) is conjugate acid of S-carboxylatomethyl-L-cysteine(1−) (CHEBI:57662) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-[(carboxylatomethyl)sulfanyl]propanoate |
| Synonyms | Source |
|---|---|
| S-carboxymethyl-L-cysteine anion | ChEBI |
| S-(carboxylatomethyl)-L-cysteine | ChEBI |
| (2R)-2-ammonio-3-[(carboxylatomethyl)sulfanyl]propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| S-carboxymethyl-L-cysteine | UniProt |