EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO4S |
| Net Charge | 0 |
| Average Mass | 179.197 |
| Monoisotopic Mass | 179.02523 |
| SMILES | N[C@@H](CSCC(=O)O)C(=O)O |
| InChI | InChI=1S/C5H9NO4S/c6-3(5(9)10)1-11-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | GBFLZEXEOZUWRN-VKHMYHEASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | mucolytic A compound that alters the structure of mucus so as to decrease its viscosity and thereby facilitate its removal by ciliary action and expectoration. Compare with antitussives, which suppress the cough reflex, and expectorants, which are considered to increase the volume of secretions in the respiratory tract, so facilitating their removal by ciliary action and coughing. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-carboxymethyl-L-cysteine (CHEBI:16163) has role mucolytic (CHEBI:77034) |
| S-carboxymethyl-L-cysteine (CHEBI:16163) is a L-cysteine thioether (CHEBI:27532) |
| S-carboxymethyl-L-cysteine (CHEBI:16163) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| S-carboxymethyl-L-cysteine (CHEBI:16163) is conjugate acid of S-carboxylatomethyl-L-cysteine(1−) (CHEBI:57662) |
| Incoming Relation(s) |
| S-carboxylatomethyl-L-cysteine(1−) (CHEBI:57662) is conjugate base of S-carboxymethyl-L-cysteine (CHEBI:16163) |
| IUPAC Names |
|---|
| (2R)-2-amino-3-[(carboxymethyl)sulfanyl]propanoic acid |
| S-(carboxymethyl)-L-cysteine |
| INNs | Source |
|---|---|
| carbocisteína | WHO MedNet |
| carbocisteine | WHO MedNet |
| carbocistéine | WHO MedNet |
| carbocisteinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| carbocysteine | ChemIDplus |
| S-carboxymethylcysteine | ChEBI |
| S-(carboxymethyl)-(R)-cysteine | ChemIDplus |
| (R)-S-(carboxymethyl)cysteine | ChemIDplus |
| (L)-2-Amino-3-(carboxymethylthio)propionic acid | ChemIDplus |
| L-Carbocisteine | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Mucodyne | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 4160 | DrugCentral |
| C03727 | KEGG COMPOUND |
| Carbocisteine | Wikipedia |
| CCS | PDBeChem |
| CPD-44 | MetaCyc |
| D00175 | KEGG DRUG |
| HMDB0029415 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1043764 | Gmelin |
| Reaxys:1725012 | Reaxys |
| CAS:638-23-3 | KEGG COMPOUND |
| CAS:638-23-3 | ChemIDplus |
| Citations |
|---|