EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | -2 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02771 |
| SMILES | C=C(C(=O)[O-])C(C)C(=O)[O-] |
| InChI | InChI=1S/C6H8O4/c1-3(5(7)8)4(2)6(9)10/h4H,1H2,2H3,(H,7,8)(H,9,10)/p-2 |
| InChIKey | IZFHMLDRUVYBGK-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylene-3-methylsuccinate(2−) (CHEBI:57637) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-methylene-3-methylsuccinate(2−) (CHEBI:57637) is conjugate base of 2-methylene-3-methylsuccinic acid (CHEBI:16093) |
| Incoming Relation(s) |
| 2-methylene-3-methylsuccinic acid (CHEBI:16093) is conjugate acid of 2-methylene-3-methylsuccinate(2−) (CHEBI:57637) |
| IUPAC Name |
|---|
| 2-methyl-3-methylidenebutanedioate |
| Synonyms | Source |
|---|---|
| 2-methyl-3-methylenesuccinate | ChEBI |
| 2-methylene-3-methylsuccinate dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-methylene-3-methylsuccinate | UniProt |