EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | C=C(C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C6H8O4/c1-3(5(7)8)4(2)6(9)10/h4H,1H2,2H3,(H,7,8)(H,9,10) |
| InChIKey | IZFHMLDRUVYBGK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methylene-3-methylsuccinic acid (CHEBI:16093) has functional parent succinic acid (CHEBI:15741) |
| 2-methylene-3-methylsuccinic acid (CHEBI:16093) is a dicarboxylic acid (CHEBI:35692) |
| 2-methylene-3-methylsuccinic acid (CHEBI:16093) is a olefinic compound (CHEBI:78840) |
| 2-methylene-3-methylsuccinic acid (CHEBI:16093) is conjugate acid of 2-methylene-3-methylsuccinate(2−) (CHEBI:57637) |
| Incoming Relation(s) |
| 2-methylene-3-methylsuccinate(2−) (CHEBI:57637) is conjugate base of 2-methylene-3-methylsuccinic acid (CHEBI:16093) |
| IUPAC Name |
|---|
| 2-methyl-3-methylidenebutanedoic acid |
| Synonyms | Source |
|---|---|
| Methylitaconate | KEGG COMPOUND |
| 2-Methylene-3-methylsuccinate | KEGG COMPOUND |
| methylitaconic acid | ChEBI |
| Citations |
|---|