EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N4O9P |
| Net Charge | -2 |
| Average Mass | 456.348 |
| Monoisotopic Mass | 456.10571 |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)([O-])[O-])c1nc(=O)nc(=O)c1N2 |
| InChI | InChI=1S/C17H23N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,18,22-24H,5-6H2,1-2H3,(H2,27,28,29)(H2,19,20,25,26)/p-2/t11-,12+,14-/m0/s1 |
| InChIKey | YTNIXZGTHTVJBW-SCRDCRAPSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FMNH2(2−) (CHEBI:57618) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| FMNH2(2−) (CHEBI:57618) has role cofactor (CHEBI:23357) |
| FMNH2(2−) (CHEBI:57618) is a organophosphate oxoanion (CHEBI:58945) |
| FMNH2(2−) (CHEBI:57618) is conjugate acid of FMNH2(3−) (CHEBI:133886) |
| FMNH2(2−) (CHEBI:57618) is conjugate base of FMNH2 (CHEBI:16048) |
| Incoming Relation(s) |
| N5-dimethylallyl-FMNH2(2−) (CHEBI:231955) has functional parent FMNH2(2−) (CHEBI:57618) |
| FMNH2 (CHEBI:16048) is conjugate acid of FMNH2(2−) (CHEBI:57618) |
| FMNH2(3−) (CHEBI:133886) is conjugate base of FMNH2(2−) (CHEBI:57618) |
| IUPAC Name |
|---|
| 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-1,3,4,5-tetrahydrobenzo[g]pteridin-10(2H)-yl)-5-O-phosphonato-D-ribitol |
| Synonyms | Source |
|---|---|
| 1,5-dihydroriboflavin 5'-phosphate | ChEBI |
| FMNH2 dianion | ChEBI |
| reduced flavin mononucleotide dianion | ChEBI |
| reduced FMN(2−) | ChEBI |
| reduced FMN dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| FMNH2 | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6258176 | Beilstein |