EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20N4O9P |
| Net Charge | -3 |
| Average Mass | 455.340 |
| Monoisotopic Mass | 455.09844 |
| SMILES | Cc1cc2c(cc1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(=O)([O-])[O-])c1[n-]c(=O)nc(=O)c1N2 |
| InChI | InChI=1S/C17H23N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,18,22-24H,5-6H2,1-2H3,(H4,19,20,25,26,27,28,29)/p-3/t11-,12+,14-/m0/s1 |
| InChIKey | PFFFVMLSJAOGEY-SCRDCRAPSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| FMNH2(3−) (CHEBI:133886) is a organophosphate oxoanion (CHEBI:58945) |
| FMNH2(3−) (CHEBI:133886) is conjugate base of FMNH2 (CHEBI:16048) |
| FMNH2(3−) (CHEBI:133886) is conjugate base of FMNH2(2−) (CHEBI:57618) |
| Incoming Relation(s) |
| FMNH2 (CHEBI:16048) is conjugate acid of FMNH2(3−) (CHEBI:133886) |
| FMNH2(2−) (CHEBI:57618) is conjugate acid of FMNH2(3−) (CHEBI:133886) |
| IUPAC Name |
|---|
| 1-deoxy-1-(7,8-dimethyl-2,4-dioxo-3,4-dihydro-2H-benzo[g]pteridin-1-id-10(5H)-yl)-5-O-phosphonato-D-ribitol |
| Citations |
|---|