EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N5O14P3 |
| Net Charge | -3 |
| Average Mass | 520.157 |
| Monoisotopic Mass | 519.96883 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/p-3/t3-,5-,6-,9-/m1/s1 |
| InChIKey | XKMLYUALXHKNFT-UUOKFMHZSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GTP(3−) (CHEBI:57600) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| GTP(3−) (CHEBI:57600) is a guanosine 5'-phosphate (CHEBI:37121) |
| GTP(3−) (CHEBI:57600) is a organophosphate oxoanion (CHEBI:58945) |
| GTP(3−) (CHEBI:57600) is conjugate acid of GTP(4−) (CHEBI:37565) |
| GTP(3−) (CHEBI:57600) is conjugate base of GTP (CHEBI:15996) |
| Incoming Relation(s) |
| 7-methyl-GTP(3−) (CHEBI:87133) has functional parent GTP(3−) (CHEBI:57600) |
| GTP (CHEBI:15996) is conjugate acid of GTP(3−) (CHEBI:57600) |
| GTP(4−) (CHEBI:37565) is conjugate base of GTP(3−) (CHEBI:57600) |
| IUPAC Name |
|---|
| 5'-O-[({[(hydroxyphosphinato)oxy]phosphinato}oxy)phosphinato]guanosine |
| Synonyms | Source |
|---|---|
| GTP trianion | ChEBI |
| guanosine 5'-triphosphate(3−) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4285687 | Beilstein |
| Gmelin:2507814 | Gmelin |