EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O14P3 |
| Net Charge | -4 |
| Average Mass | 519.149 |
| Monoisotopic Mass | 518.96155 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H16N5O14P3/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(27-9)1-26-31(22,23)29-32(24,25)28-30(19,20)21/h2-3,5-6,9,16-17H,1H2,(H,22,23)(H,24,25)(H2,19,20,21)(H3,11,13,14,18)/p-4/t3-,5-,6-,9-/m1/s1 |
| InChIKey | XKMLYUALXHKNFT-UUOKFMHZSA-J |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GTP(4−) (CHEBI:37565) has role human metabolite (CHEBI:77746) |
| GTP(4−) (CHEBI:37565) is a nucleoside 5'-triphoshate(4−) (CHEBI:61557) |
| GTP(4−) (CHEBI:37565) is conjugate base of GTP(3−) (CHEBI:57600) |
| Incoming Relation(s) |
| N2-(1-hydroxy-2-oxoethyl)-GTP(4−) (CHEBI:141571) has functional parent GTP(4−) (CHEBI:37565) |
| N2-(1-hydroxy-2-oxopropyl)-GTP(4−) (CHEBI:141570) has functional parent GTP(4−) (CHEBI:37565) |
| 3'-deoxy-3',4'-didehydro-GTP(4−) (CHEBI:191857) has functional parent GTP(4−) (CHEBI:37565) |
| N2-(ADP-D-ribosyl)-GTP(6−) (CHEBI:142719) has functional parent GTP(4−) (CHEBI:37565) |
| GTP(3−) (CHEBI:57600) is conjugate acid of GTP(4−) (CHEBI:37565) |
| IUPAC Name |
|---|
| guanosine 5'-triphosphate(4−) |
| Synonym | Source |
|---|---|
| gtp | ChEBI |
| UniProt Name | Source |
|---|---|
| GTP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1264613 | Gmelin |
| Beilstein:5211792 | Beilstein |