EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O4 |
| Net Charge | 0 |
| Average Mass | 199.166 |
| Monoisotopic Mass | 199.05931 |
| SMILES | [NH3+][C@@H](Cn1ccc(=O)nc1=O)C(=O)[O-] |
| InChI | InChI=1S/C7H9N3O4/c8-4(6(12)13)3-10-2-1-5(11)9-7(10)14/h1-2,4H,3,8H2,(H,12,13)(H,9,11,14)/t4-/m0/s1 |
| InChIKey | FACUYWPMDKTVFU-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(uracil-1-yl)-L-alanine zwitterion (CHEBI:57543) is a amino-acid zwitterion (CHEBI:35238) |
| 3-(uracil-1-yl)-L-alanine zwitterion (CHEBI:57543) is tautomer of 3-(uracil-1-yl)-L-alanine (CHEBI:15851) |
| Incoming Relation(s) |
| 3-(uracil-1-yl)-L-alanine (CHEBI:15851) is tautomer of 3-(uracil-1-yl)-L-alanine zwitterion (CHEBI:57543) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)propanoate |
| Synonym | Source |
|---|---|
| (2S)-2-azaniumyl-3-(2,4-dioxo-1,2,3,4-tetrahydropyrimidin-1-yl)propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-(uracil-1-yl)-L-alanine | UniProt |