EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9N3O4 |
| Net Charge | 0 |
| Average Mass | 199.166 |
| Monoisotopic Mass | 199.05931 |
| SMILES | N[C@@H](Cn1ccc(=O)nc1=O)C(=O)O |
| InChI | InChI=1S/C7H9N3O4/c8-4(6(12)13)3-10-2-1-5(11)9-7(10)14/h1-2,4H,3,8H2,(H,12,13)(H,9,11,14)/t4-/m0/s1 |
| InChIKey | FACUYWPMDKTVFU-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(uracil-1-yl)-L-alanine (CHEBI:15851) has functional parent uracil (CHEBI:17568) |
| 3-(uracil-1-yl)-L-alanine (CHEBI:15851) is a L-alanine derivative (CHEBI:83943) |
| 3-(uracil-1-yl)-L-alanine (CHEBI:15851) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-(uracil-1-yl)-L-alanine (CHEBI:15851) is tautomer of 3-(uracil-1-yl)-L-alanine zwitterion (CHEBI:57543) |
| Incoming Relation(s) |
| 3-(uracil-1-yl)-L-alanine zwitterion (CHEBI:57543) is tautomer of 3-(uracil-1-yl)-L-alanine (CHEBI:15851) |
| IUPAC Name |
|---|
| 3-(2,4-dioxo-3,4-dihydropyrimidin-1(2H)-yl)-L-alanine |
| Synonyms | Source |
|---|---|
| 3-(Uracil-1-yl)-L-alanine | KEGG COMPOUND |
| Willardiine | KEGG COMPOUND |
| 3-(uracil-1-yl)-L-alanine | ChEBI |
| 2-AMINO-3-(2,4-DIOXO-3,4-DIHYDRO-2H-PYRIMIDIN-1-YL)-PROPIONIC ACID | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:20710 | Beilstein |
| CAS:21416-43-3 | KEGG COMPOUND |
| CAS:21416-43-3 | ChemIDplus |