EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H6NO6S |
| Net Charge | -1 |
| Average Mass | 184.149 |
| Monoisotopic Mass | 183.99213 |
| SMILES | [NH3+][C@@H](COS(=O)(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C3H7NO6S/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/p-1/t2-/m0/s1 |
| InChIKey | LFZGUGJDVUUGLK-REOHCLBHSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-serine O-sulfate(1−) (CHEBI:57531) is a organosulfate oxoanion (CHEBI:58958) |
| L-serine O-sulfate(1−) (CHEBI:57531) is conjugate base of L-serine O-sulfate (CHEBI:15829) |
| Incoming Relation(s) |
| L-serine O-sulfate (CHEBI:15829) is conjugate acid of L-serine O-sulfate(1−) (CHEBI:57531) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(sulfonatooxy)propanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-3-(sulfonatooxy)propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-serine O-sulfate | UniProt |