EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:15829 - L-serine O-sulfate
| Formula | C3H7NO6S |
| Net Charge | 0 |
| Average Mass | 185.157 |
| Monoisotopic Mass | 184.99941 |
| SMILES | N[C@@H](COS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C3H7NO6S/c4-2(3(5)6)1-10-11(7,8)9/h2H,1,4H2,(H,5,6)(H,7,8,9)/t2-/m0/s1 |
| InChIKey | LFZGUGJDVUUGLK-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-serine O-sulfate (CHEBI:15829) is a O-sulfoamino acid (CHEBI:37862) |
| L-serine O-sulfate (CHEBI:15829) is a L-serine derivative (CHEBI:84135) |
| L-serine O-sulfate (CHEBI:15829) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-serine O-sulfate (CHEBI:15829) is conjugate acid of L-serine O-sulfate(1−) (CHEBI:57531) |
| Incoming Relation(s) |
| L-serine O-sulfate(1−) (CHEBI:57531) is conjugate base of L-serine O-sulfate (CHEBI:15829) |
| IUPAC Name |
|---|
| L-serine O-(hydrogen sulfate) |
| Synonyms | Source |
|---|---|
| L-Serine O-sulfate | KEGG COMPOUND |
| O-sulfonato-L-serine | IUPAC |
| Serine O-sulfate | ChemIDplus |
| Citations |
|---|