EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N5O16P2 |
| Net Charge | -2 |
| Average Mass | 603.327 |
| Monoisotopic Mass | 603.06260 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/p-2/t4-,5-,7-,8-,9+,10-,11+,14-,15-/m1/s1 |
| InChIKey | MVMSCBBUIHUTGJ-GDJBGNAASA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP-α-D-mannose(2−) (CHEBI:57527) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| GDP-α-D-mannose(2−) (CHEBI:57527) has role human metabolite (CHEBI:77746) |
| GDP-α-D-mannose(2−) (CHEBI:57527) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| GDP-α-D-mannose(2−) (CHEBI:57527) is conjugate base of GDP-α-D-mannose (CHEBI:15820) |
| Incoming Relation(s) |
| GDP-α-D-mannose (CHEBI:15820) is conjugate acid of GDP-α-D-mannose(2−) (CHEBI:57527) |
| IUPAC Name |
|---|
| guanosine 5'-[3-(α-D-mannopyranosyl) diphosphate] |
| Synonym | Source |
|---|---|
| GDP-α-D-mannose dianion | ChEBI |
| UniProt Name | Source |
|---|---|
| GDP-α-D-mannose | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:6630718 | Beilstein |