EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N5O16P2 |
| Net Charge | 0 |
| Average Mass | 605.343 |
| Monoisotopic Mass | 605.07715 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)O[C@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]4O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C16H25N5O16P2/c17-16-19-12-6(13(28)20-16)18-3-21(12)14-10(26)8(24)5(34-14)2-33-38(29,30)37-39(31,32)36-15-11(27)9(25)7(23)4(1-22)35-15/h3-5,7-11,14-15,22-27H,1-2H2,(H,29,30)(H,31,32)(H3,17,19,20,28)/t4-,5-,7-,8-,9+,10-,11+,14-,15-/m1/s1 |
| InChIKey | MVMSCBBUIHUTGJ-GDJBGNAASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | - | PubMed (12805618) | |
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Homo sapiens (ncbitaxon:9606) | - | PubMed (12651883) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GDP-α-D-mannose (CHEBI:15820) has role Escherichia coli metabolite (CHEBI:76971) |
| GDP-α-D-mannose (CHEBI:15820) has role human metabolite (CHEBI:77746) |
| GDP-α-D-mannose (CHEBI:15820) has role mouse metabolite (CHEBI:75771) |
| GDP-α-D-mannose (CHEBI:15820) has role plant metabolite (CHEBI:76924) |
| GDP-α-D-mannose (CHEBI:15820) is a GDP-D-mannose (CHEBI:84880) |
| GDP-α-D-mannose (CHEBI:15820) is conjugate acid of GDP-α-D-mannose(2−) (CHEBI:57527) |
| Incoming Relation(s) |
| GDP-4-dehydro-3,6-dideoxy-α-D-mannose (CHEBI:73940) has functional parent GDP-α-D-mannose (CHEBI:15820) |
| GDP-4-dehydro-6-deoxy-α-D-mannose (CHEBI:16955) has functional parent GDP-α-D-mannose (CHEBI:15820) |
| GDP-6-deoxy-α-D-mannose (CHEBI:17661) has functional parent GDP-α-D-mannose (CHEBI:15820) |
| GDP-α-D-mannose(2−) (CHEBI:57527) is conjugate base of GDP-α-D-mannose (CHEBI:15820) |
| IUPAC Name |
|---|
| guanosine 5'-[3-(α-D-mannopyranosyl) dihydrogen diphosphate] |
| Synonyms | Source |
|---|---|
| GDP-D-mannose | KEGG COMPOUND |
| GDPmannose | KEGG COMPOUND |
| Guanosine 5'-(trihydrogen diphosphate), mono-alpha-D-mannopyranosyl ester | ChemIDplus |
| Guanosine diphosphate mannose | ChemIDplus |
| Guanosine diphosphomannose | ChemIDplus |
| Guanosine pyrophosphate mannose | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00007246 | KNApSAcK |
| C00096 | KEGG COMPOUND |
| C00096 | KEGG COMPOUND |
| G10614 | KEGG GLYCAN |
| GDD | PDBeChem |
| GDP-MANNOSE | MetaCyc |
| HMDB0001163 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:79013 | Reaxys |
| CAS:3123-67-9 | KEGG COMPOUND |
| CAS:3123-67-9 | ChemIDplus |
| Citations |
|---|