EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H3O6 |
| Net Charge | -3 |
| Average Mass | 183.095 |
| Monoisotopic Mass | 182.99461 |
| SMILES | O=C([O-])/C=C\C(=C/C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H6O6/c8-5(9)2-1-4(7(12)13)3-6(10)11/h1-3H,(H,8,9)(H,10,11)(H,12,13)/p-3/b2-1-,4-3+ |
| InChIKey | KJOVGYUGXHIVAY-BXTBVDPRSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-carboxy-cis,cis-muconate(3−) (CHEBI:57496) is a tricarboxylic acid trianion (CHEBI:27092) |
| 3-carboxy-cis,cis-muconate(3−) (CHEBI:57496) is conjugate base of 3-carboxy-cis,cis-muconic acid (CHEBI:15749) |
| Incoming Relation(s) |
| 3-carboxy-cis,cis-muconic acid (CHEBI:15749) is conjugate acid of 3-carboxy-cis,cis-muconate(3−) (CHEBI:57496) |
| IUPAC Name |
|---|
| (1E,3Z)-buta-1,3-diene-1,2,4-tricarboxylate |
| Synonym | Source |
|---|---|
| 3-carboxy-cis,cis-muconate trianion | ChEBI |
| UniProt Name | Source |
|---|---|
| 3-carboxy-cis,cis-muconate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3958330 | Beilstein |