EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O6 |
| Net Charge | 0 |
| Average Mass | 186.119 |
| Monoisotopic Mass | 186.01644 |
| SMILES | O=C(O)/C=C\C(=C/C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H6O6/c8-5(9)2-1-4(7(12)13)3-6(10)11/h1-3H,(H,8,9)(H,10,11)(H,12,13)/b2-1-,4-3+ |
| InChIKey | KJOVGYUGXHIVAY-BXTBVDPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-carboxy-cis,cis-muconic acid (CHEBI:15749) is a tricarboxylic acid (CHEBI:27093) |
| 3-carboxy-cis,cis-muconic acid (CHEBI:15749) is conjugate acid of 3-carboxy-cis,cis-muconate(3−) (CHEBI:57496) |
| Incoming Relation(s) |
| 3-carboxy-cis,cis-muconate(3−) (CHEBI:57496) is conjugate base of 3-carboxy-cis,cis-muconic acid (CHEBI:15749) |
| IUPAC Name |
|---|
| (1E,3Z)-buta-1,3-diene-1,2,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 3-carboxy-cis,cis-muconate | ChEBI |
| 3-Carboxy-cis,cis-muconate | KEGG COMPOUND |
| beta-carboxy-cis,cis-muconate | ChEBI |
| beta-Carboxy-cis,cis-muconate | KEGG COMPOUND |
| cis,cis-butadiene-1,2,4-tricarboxylate | ChEBI |
| cis,cis-Butadiene-1,2,4-tricarboxylate | KEGG COMPOUND |